EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O7 |
| Net Charge | 0 |
| Average Mass | 362.378 |
| Monoisotopic Mass | 362.13655 |
| SMILES | CC(C)=CCc1c(O)c(C)c(O)c2c1[C@@H]([C@@]1(C)C[C@@H](O)C(=O)O1)OC2=O |
| InChI | InChI=1S/C19H22O7/c1-8(2)5-6-10-12-13(15(22)9(3)14(10)21)18(24)25-16(12)19(4)7-11(20)17(23)26-19/h5,11,16,20-22H,6-7H2,1-4H3/t11-,16+,19-/m1/s1 |
| InChIKey | YZBQWOKLCWGSMK-XNPNBVRTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium cancroideum (ncbitaxon:874300) | - | PubMed (26549741) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chaetophenol G (CHEBI:209377) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (3S)-5,7-dihydroxy-3-[(2R,4R)-4-hydroxy-2-methyl-5-oxooxolan-2-yl]-6-methyl-4-(3-methylbut-2-enyl)-3H-2-benzouran-1-one |
| Manual Xrefs | Databases |
|---|---|
| 78437934 | ChemSpider |