EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16N2O9S2 |
| Net Charge | 0 |
| Average Mass | 408.410 |
| Monoisotopic Mass | 408.02972 |
| SMILES | CC(=O)N/C=C/S(=O)C1=C(C(=O)O)N2C(=O)C(C(C)OS(=O)(=O)O)C2C1 |
| InChI | InChI=1S/C13H16N2O9S2/c1-6(24-26(21,22)23)10-8-5-9(25(20)4-3-14-7(2)16)11(13(18)19)15(8)12(10)17/h3-4,6,8,10H,5H2,1-2H3,(H,14,16)(H,18,19)(H,21,22,23)/b4-3+ |
| InChIKey | OIUMWDNCAIKVGD-ONEGZZNKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (24420617) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| MM 4550 (CHEBI:209356) is a carbapenems (CHEBI:46633) |
| IUPAC Name |
|---|
| 3-[(E)-2-acetamidoethenyl]sulinyl-7-oxo-6-(1-sulooxyethyl)-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 8539535 | ChemSpider |