EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H15NO2 |
| Net Charge | 0 |
| Average Mass | 229.279 |
| Monoisotopic Mass | 229.11028 |
| SMILES | CC(C)=CCc1ccc2ncc(C(=O)O)c2c1 |
| InChI | InChI=1S/C14H15NO2/c1-9(2)3-4-10-5-6-13-11(7-10)12(8-15-13)14(16)17/h3,5-8,15H,4H2,1-2H3,(H,16,17) |
| InChIKey | QQVACXOIVZONIF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (18408326) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-Dimethylallylindole-3-carboxylic acid (CHEBI:209285) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| 5-(3-methylbut-2-enyl)-1H-indole-3-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 27023353 | ChemSpider |