EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H40 |
| Net Charge | 0 |
| Average Mass | 340.595 |
| Monoisotopic Mass | 340.31300 |
| SMILES | C=C(CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)[C@@H]1CC=C(C)CC1 |
| InChI | InChI=1S/C25H40/c1-20(2)10-7-11-21(3)12-8-13-22(4)14-9-15-24(6)25-18-16-23(5)17-19-25/h10,12,14,16,25H,6-9,11,13,15,17-19H2,1-5H3/b21-12+,22-14+/t25-/m1/s1 |
| InChIKey | BGFULIZGCATQRB-WWYOOSCYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces somaliensis (ncbitaxon:78355) | - | PubMed (29553734) | Gene expressed in an engineered Escherichia coli strain. |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-somaliensene B (CHEBI:209277) has role bacterial metabolite (CHEBI:76969) |
| (−)-somaliensene B (CHEBI:209277) is a carbocyclic compound (CHEBI:33598) |
| (−)-somaliensene B (CHEBI:209277) is a cyclic olefin (CHEBI:33642) |
| (−)-somaliensene B (CHEBI:209277) is a polyene (CHEBI:48121) |
| (−)-somaliensene B (CHEBI:209277) is a sesterterpene (CHEBI:35192) |
| (−)-somaliensene B (CHEBI:209277) is enantiomer of (+)-somaliensene B (CHEBI:228262) |
| Incoming Relation(s) |
| (+)-somaliensene B (CHEBI:228262) is enantiomer of (−)-somaliensene B (CHEBI:209277) |
| IUPAC Name |
|---|
| (4S)-1-methyl-4-[(5E,9E)-6,10,14-trimethylpentadeca-1,5,9,13-tetraen-2-yl]cyclohexene |
| Synonym | Source |
|---|---|
| somaliensene B | ChEBI |
| UniProt Name | Source |
|---|---|
| (−)-somaliensene B | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 78439055 | ChemSpider |
| CPD-26716 | MetaCyc |
| LMPR0105020005 | LIPID MAPS |
| Citations |
|---|