EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H17N3O8 |
| Net Charge | 0 |
| Average Mass | 319.270 |
| Monoisotopic Mass | 319.10156 |
| SMILES | NC1=N[C@H](O)[C@H]2[C@H]3O[C@]4(O)O[C@@H](C(O)[C@@]2(N1)[C@@H]4O)[C@]3(O)CO |
| InChI | InChI=1S/C11H17N3O8/c12-8-13-6(17)2-4-9(19,1-15)5-3(16)10(2,14-8)7(18)11(20,21-4)22-5/h2-7,15-20H,1H2,(H3,12,13,14)/t2-,3?,4-,5+,6-,7+,9+,10-,11+/m1/s1 |
| InChIKey | CFMYXEVWODSLAX-HUILCFQTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillusspecies 1839 (ncbitaxon:1387054) | - | PubMed (31847253) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+/-)-tetrodotoxin (CHEBI:209255) has functional parent tetrodotoxin (CHEBI:9506) |
| (+/-)-tetrodotoxin (CHEBI:209255) is a quinazoline alkaloid (CHEBI:36470) |
| IUPAC Name |
|---|
| (1R,5R,6R,7R,9S,11S,13S,14S)-3-amino-14-(hydroxymethyl)-8,10-dioxa-2,4-diazatetracyclo[7.3.1.17,11.01,6]tetradec-3-ene-5,9,12,13,14-pentol |
| Manual Xrefs | Databases |
|---|---|
| 16736198 | ChemSpider |