EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H32N2O5 |
| Net Charge | 0 |
| Average Mass | 440.540 |
| Monoisotopic Mass | 440.23112 |
| SMILES | CCC[C@@H]1C/C=C(\C)C(=O)CC(=O)N[C@H](Cc2ccccc2)C(=O)N2CCC[C@H]2C(=O)O1 |
| InChI | InChI=1S/C25H32N2O5/c1-3-8-19-13-12-17(2)22(28)16-23(29)26-20(15-18-9-5-4-6-10-18)24(30)27-14-7-11-21(27)25(31)32-19/h4-6,9-10,12,19-21H,3,7-8,11,13-16H2,1-2H3,(H,26,29)/b17-12+/t19-,20-,21+/m1/s1 |
| InChIKey | YSNFMBLAIYADSY-CUXCDPHNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sarocladium (ncbitaxon:284134) | - | PubMed (29498850) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Saroclide A (CHEBI:209247) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (3R,8E,11R,14S)-3-benzyl-8-methyl-11-propyl-12-oxa-1,4-diazabicyclo[12.3.0]heptadec-8-ene-2,5,7,13-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 65323279 | ChemSpider |