EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26O3 |
| Net Charge | 0 |
| Average Mass | 302.414 |
| Monoisotopic Mass | 302.18819 |
| SMILES | C=C[C@@]1(C)CCC2=C(C(=O)C=C3C(C)(C)CCC[C@]32O)[C@H]1O |
| InChI | InChI=1S/C19H26O3/c1-5-18(4)10-7-12-15(16(18)21)13(20)11-14-17(2,3)8-6-9-19(12,14)22/h5,11,16,21-22H,1,6-10H2,2-4H3/t16-,18+,19-/m1/s1 |
| InChIKey | LPJQROAWMVXSMD-NZSAHSFTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (30423951) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aspewentin J (CHEBI:209215) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (4aR,7R,8S)-7-ethenyl-4a,8-dihydroxy-1,1,7-trimethyl-2,3,4,5,6,8-hexahydrophenanthren-9-one |
| Manual Xrefs | Databases |
|---|---|
| 70999824 | ChemSpider |