EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18N2O3 |
| Net Charge | 0 |
| Average Mass | 334.375 |
| Monoisotopic Mass | 334.13174 |
| SMILES | O=C(O)[C@H](O)Cc1c(Cc2cnc3ccccc23)nc2ccccc12 |
| InChI | InChI=1S/C20H18N2O3/c23-19(20(24)25)10-15-14-6-2-4-8-17(14)22-18(15)9-12-11-21-16-7-3-1-5-13(12)16/h1-8,11,19,21-23H,9-10H2,(H,24,25)/t19-/m1/s1 |
| InChIKey | RDMJEPLAAAUXIZ-LJQANCHMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malassezia furfur (ncbitaxon:55194) | - | DOI (10.1002/hlca.200590118) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Malabetaezialactic acid (CHEBI:209171) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| (2R)-2-hydroxy-3-[2-(1H-indol-3-ylmethyl)-1H-indol-3-yl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78437385 | ChemSpider |