EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H13N3O5S |
| Net Charge | 0 |
| Average Mass | 359.363 |
| Monoisotopic Mass | 359.05759 |
| SMILES | O=C(N[C@@H](CS)C(=O)O)c1coc(-c2nc3ccccc3cc2O)n1 |
| InChI | InChI=1S/C16H13N3O5S/c20-12-5-8-3-1-2-4-9(8)17-13(12)15-19-10(6-24-15)14(21)18-11(7-25)16(22)23/h1-6,11,20,25H,7H2,(H,18,21)(H,22,23)/t11-/m0/s1 |
| InChIKey | RBQMFLPOEYGTJP-NSHDSACASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (30297652) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R)-2-[[2-(3-hydroxyquinolin-2-yl)-1,3-oxazole-4-carbonyl]amino]-3-sulanylpropanoic acid (CHEBI:209169) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| (2R)-2-[[2-(3-hydroxyquinolin-2-yl)-1,3-oxazole-4-carbonyl]amino]-3-sulanylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 71048866 | ChemSpider |