EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H15N3O5 |
| Net Charge | 0 |
| Average Mass | 317.301 |
| Monoisotopic Mass | 317.10117 |
| SMILES | NC(=O)CC[C@H](NC(=O)c1nc2ccccc2cc1O)C(=O)O |
| InChI | InChI=1S/C15H15N3O5/c16-12(20)6-5-10(15(22)23)18-14(21)13-11(19)7-8-3-1-2-4-9(8)17-13/h1-4,7,10,19H,5-6H2,(H2,16,20)(H,18,21)(H,22,23)/t10-/m0/s1 |
| InChIKey | SUYSEAZIUVYHDG-JTQLQIEISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (30297652) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-5-amino-2-[(3-hydroxyquinoline-2-carbonyl)amino]-5-oxopentanoic acid (CHEBI:209163) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| (2S)-5-amino-2-[(3-hydroxyquinoline-2-carbonyl)amino]-5-oxopentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 71048865 | ChemSpider |