EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H19N3O5 |
| Net Charge | 0 |
| Average Mass | 429.432 |
| Monoisotopic Mass | 429.13247 |
| SMILES | COC(=O)[C@@]1(c2ccccc2)OC(=O)c2c1ccc1c2N(C)c2cccc(C(N)=O)c2N1 |
| InChI | InChI=1S/C24H19N3O5/c1-27-17-10-6-9-14(21(25)28)19(17)26-16-12-11-15-18(20(16)27)22(29)32-24(15,23(30)31-2)13-7-4-3-5-8-13/h3-12,26H,1-2H3,(H2,25,28)/t24-/m0/s1 |
| InChIKey | DFGUDCVWSOKLAH-DEOSSOPVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dermacoccus abyssi (ncbitaxon:322596) | - | PubMed (20448892) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dermacozine D (CHEBI:209129) is a aromatic amine (CHEBI:33860) |
| Dermacozine D (CHEBI:209129) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| methyl (3S)-7-carbamoyl-11-methyl-1-oxo-3-phenyl-6H-uro[3,4-a]phenazine-3-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 27024767 | ChemSpider |