EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H45Cl2N4O10P |
| Net Charge | 0 |
| Average Mass | 795.654 |
| Monoisotopic Mass | 794.22504 |
| SMILES | CO[C@@H]1C(=O)O[C@H](C)[C@@H](C)/C=C(/C)C[C@H](C)C(=O)N[C@@H](C)C(=O)N(C)[C@H](Cc2c(Cl)nc3ccccc23)C(=O)NC1c1ccc(OP(=O)(O)O)c(Cl)c1 |
| InChI | InChI=1S/C36H45Cl2N4O10P/c1-18-14-19(2)22(5)51-36(46)31(50-7)30(23-12-13-29(26(37)16-23)52-53(47,48)49)41-34(44)28(17-25-24-10-8-9-11-27(24)40-32(25)38)42(6)35(45)21(4)39-33(43)20(3)15-18/h8-14,16,19-22,28,30-31,40H,15,17H2,1-7H3,(H,39,43)(H,41,44)(H2,47,48,49)/b18-14-/t19-,20-,21-,22+,28+,30?,31-/m0/s1 |
| InChIKey | DDAIRXLBIPWGAO-PPAQWXKVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chondromyces (ncbitaxon:50) | - | PubMed (23959765) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chrondramide 10 (CHEBI:209119) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| [2-chloro-4-[(3S,7R,10S,13S,15Z,17S,18R)-7-[(2-chloro-1H-indol-3-yl)methyl]-3-methoxy-8,10,13,15,17,18-hexamethyl-2,6,9,12-tetraoxo-1-oxa-5,8,11-triazacyclooctadec-15-en-4-yl]phenyl] dihydrogen phosphate |
| Manual Xrefs | Databases |
|---|---|
| 78442620 | ChemSpider |