EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18O5 |
| Net Charge | 0 |
| Average Mass | 266.293 |
| Monoisotopic Mass | 266.11542 |
| SMILES | CC(=O)C1=CC[C@]23CO[C@H](C2)[C@@](O)(C(=O)O)CC[C@@H]13 |
| InChI | InChI=1S/C14H18O5/c1-8(15)9-2-4-13-6-11(19-7-13)14(18,12(16)17)5-3-10(9)13/h2,10-11,18H,3-7H2,1H3,(H,16,17)/t10-,11+,13+,14+/m0/s1 |
| InChIKey | KPGYQQMJCOACFG-OIMNJJJWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (31752168) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Piltunine E (CHEBI:209109) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| IUPAC Name |
|---|
| (1S,5R,8R,9R)-4-acetyl-8-hydroxy-10-oxatricyclo[7.2.1.01,5]dodec-3-ene-8-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 81363634 | ChemSpider |