EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24O5 |
| Net Charge | 0 |
| Average Mass | 296.363 |
| Monoisotopic Mass | 296.16237 |
| SMILES | COC(C)(C)C1=CC[C@]23CO[C@H](C2)[C@@](O)(C(=O)O)CC[C@@H]13 |
| InChI | InChI=1S/C16H24O5/c1-14(2,20-3)10-4-6-15-8-12(21-9-15)16(19,13(17)18)7-5-11(10)15/h4,11-12,19H,5-9H2,1-3H3,(H,17,18)/t11-,12+,15+,16+/m0/s1 |
| InChIKey | JPDCRXSUCOUIKK-UAXWRAGISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (31752168) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Piltunine D (CHEBI:209101) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| IUPAC Name |
|---|
| (1S,5R,8R,9R)-8-hydroxy-4-(2-methoxypropan-2-yl)-10-oxatricyclo[7.2.1.01,5]dodec-3-ene-8-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 81363633 | ChemSpider |