EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:2091 - 5-methyl-2-furaldehyde
| Formula | C6H6O2 |
| Net Charge | 0 |
| Average Mass | 110.112 |
| Monoisotopic Mass | 110.03678 |
| SMILES | [H]C(=O)c1ccc(C)o1 |
| InChI | InChI=1S/C6H6O2/c1-5-2-3-6(4-7)8-5/h2-4H,1H3 |
| InChIKey | OUDFNZMQXZILJD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | faeces (UBERON:0001988) | PubMed (17314143) |
| Roles Classification |
|---|
| Chemical Role: | Maillard reaction product Any thermal degradation product obtained as a result of a chemical reaction between an amino acid and a reducing sugar (Maillard reaction, a non-enzymatic browning procedure that usually imparts flavour to starch-based food products). |
| Biological Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. EC 2.2.1.6 (acetolactate synthase) inhibitor An EC 2.2.1.* (transketolase/transaldolase) inhibitor that interferes with the action of acetolactate synthase (EC 2.2.1.6). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-methyl-2-furaldehyde (CHEBI:2091) has role EC 2.2.1.6 (acetolactate synthase) inhibitor (CHEBI:22180) |
| 5-methyl-2-furaldehyde (CHEBI:2091) has role flavouring agent (CHEBI:35617) |
| 5-methyl-2-furaldehyde (CHEBI:2091) has role human metabolite (CHEBI:77746) |
| 5-methyl-2-furaldehyde (CHEBI:2091) has role Maillard reaction product (CHEBI:77523) |
| 5-methyl-2-furaldehyde (CHEBI:2091) is a aldehyde (CHEBI:17478) |
| 5-methyl-2-furaldehyde (CHEBI:2091) is a furans (CHEBI:24129) |
| IUPAC Name |
|---|
| 5-methylfuran-2-carbaldehyde |
| Synonyms | Source |
|---|---|
| 5-methyl-2-furfural | ChemIDplus |
| 2-methyl-5-formylfuran | ChemIDplus |
| 5-methyl-2-furancarbaldehyde | NIST Chemistry WebBook |
| 5-methyl-2-furancarboxaldehyde | ChemIDplus |
| 5-methyl furfural | ChemIDplus |
| 2-formyl-5-methylfuran | ChemIDplus |
| Citations |
|---|