EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O5 |
| Net Charge | 0 |
| Average Mass | 282.336 |
| Monoisotopic Mass | 282.14672 |
| SMILES | CC(C)=C1CC[C@@]23C[C@@H](O[C@H]2O)[C@@](O)(C(=O)O)CC[C@@H]13 |
| InChI | InChI=1S/C15H22O5/c1-8(2)9-3-5-14-7-11(20-13(14)18)15(19,12(16)17)6-4-10(9)14/h10-11,13,18-19H,3-7H2,1-2H3,(H,16,17)/t10-,11+,13+,14-,15+/m0/s1 |
| InChIKey | YXJFUNMPVSGAAH-RFBJSHEKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (31752168) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Piltunine C (CHEBI:209096) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| IUPAC Name |
|---|
| (1S,5S,8R,9R,11R)-8,11-dihydroxy-4-propan-2-ylidene-10-oxatricyclo[7.2.1.01,5]dodecane-8-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 81363632 | ChemSpider |