EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24O6 |
| Net Charge | 0 |
| Average Mass | 324.373 |
| Monoisotopic Mass | 324.15729 |
| SMILES | CC(=O)OC/C(C)=C1\CC[C@]23CO[C@H](C2)[C@@](O)(C(=O)O)CC[C@@H]13 |
| InChI | InChI=1S/C17H24O6/c1-10(8-22-11(2)18)12-3-5-16-7-14(23-9-16)17(21,15(19)20)6-4-13(12)16/h13-14,21H,3-9H2,1-2H3,(H,19,20)/b12-10+/t13-,14+,16+,17+/m0/s1 |
| InChIKey | WUDUPHAKVSKYPY-LSJBOMNLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (31752168) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Piltunine B (CHEBI:209089) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| (1S,4E,5S,8R,9R)-4-(1-acetyloxypropan-2-ylidene)-8-hydroxy-10-oxatricyclo[7.2.1.01,5]dodecane-8-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 81363631 | ChemSpider |