EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30Br2O3 |
| Net Charge | 0 |
| Average Mass | 478.265 |
| Monoisotopic Mass | 476.05617 |
| SMILES | CC(C)[C@@H]1C=CC(=O)[C@H]2[C@@H]3[C@](C)(O)[C@@H](O)C[C@H](Br)[C@@]3(C)CC[C@]12CBr |
| InChI | InChI=1S/C20H30Br2O3/c1-11(2)12-5-6-13(23)16-17-18(3,7-8-20(12,16)10-21)14(22)9-15(24)19(17,4)25/h5-6,11-12,14-17,24-25H,7-10H2,1-4H3/t12-,14-,15-,16-,17-,18+,19+,20-/m0/s1 |
| InChIKey | JGVFMEFXYFJJSK-KTPFSLFISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Staphylococcus aureus (ncbitaxon:1280) | - | PubMed (11520219) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Bromosphaerone (CHEBI:209070) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (1R,4aS,4bS,5S,6S,8S,8aS,10aS)-8-bromo-10a-(bromomethyl)-5,6-dihydroxy-5,8a-dimethyl-1-propan-2-yl-1,4a,4b,6,7,8,9,10-octahydrophenanthren-4-one |
| Manual Xrefs | Databases |
|---|---|
| 9298766 | ChemSpider |