EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O9 |
| Net Charge | 0 |
| Average Mass | 552.705 |
| Monoisotopic Mass | 552.32983 |
| SMILES | C=C[C@@]1(C)CCC2C(=CC[C@H]3[C@@](C)(CO[C@@H]4O[C@H](C(=O)OCCCC)[C@@H](O)[C@@H](O)[C@@H]4O)[C@@H](O)[C@H](O)C[C@]23C)C1 |
| InChI | InChI=1S/C30H48O9/c1-6-8-13-37-26(36)24-22(33)21(32)23(34)27(39-24)38-16-30(5)20-10-9-17-14-28(3,7-2)12-11-18(17)29(20,4)15-19(31)25(30)35/h7,9,18-25,27,31-35H,2,6,8,10-16H2,1,3-5H3/t18?,19-,20-,21-,22+,23+,24+,25+,27-,28+,29-,30-/m1/s1 |
| InChIKey | WKZOLSGWPUVAEN-KNPGLHBASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acremonium (ncbitaxon:159075) | - | PubMed (31671910) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Virescenoside Z17 (CHEBI:209060) is a steroid saponin (CHEBI:61655) |
| IUPAC Name |
|---|
| butyl (2S,3S,4R,5S,6R)-6-[[(1S,2R,3R,4aR,7S,10aR)-7-ethenyl-2,3-dihydroxy-1,4a,7-trimethyl-3,4,4b,5,6,8,10,10a-octahydro-2H-phenanthren-1-yl]methoxy]-3,4,5-trihydroxyoxane-2-carboxylate |