EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H47N5O5 |
| Net Charge | 0 |
| Average Mass | 593.769 |
| Monoisotopic Mass | 593.35772 |
| SMILES | CCC(=O)CCCCC[C@@H]1NC(=O)[C@H]2CCCCN2C(=O)[C@H](C(C)CC)NC(=O)[C@H](Cc2cnc3ccccc23)NC1=O |
| InChI | InChI=1S/C33H47N5O5/c1-4-21(3)29-33(43)38-18-12-11-17-28(38)32(42)35-26(16-8-6-7-13-23(39)5-2)30(40)36-27(31(41)37-29)19-22-20-34-25-15-10-9-14-24(22)25/h9-10,14-15,20-21,26-29,34H,4-8,11-13,16-19H2,1-3H3,(H,35,42)(H,36,40)(H,37,41)/t21?,26-,27-,28+,29-/m0/s1 |
| InChIKey | BHYPIIUJEQHYIP-FFSUGSTCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium incarnatum (ncbitaxon:298378) | - | DOI (10.1016/0040-4039(96)01844-8) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Apicidin A (CHEBI:209044) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (3S,6S,9S,12R)-3-butan-2-yl-6-(1H-indol-3-ylmethyl)-9-(6-oxooctyl)-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 421964 | ChemSpider |