EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H40N4O3 |
| Net Charge | 0 |
| Average Mass | 480.653 |
| Monoisotopic Mass | 480.31004 |
| SMILES | CC(=O)N[C@H](C(=O)N(C)[C@H](C(=O)N/C=C\c1c(CC=C(C)C)nc2ccccc12)C(C)C)C(C)C |
| InChI | InChI=1S/C28H40N4O3/c1-17(2)13-14-24-22(21-11-9-10-12-23(21)31-24)15-16-29-27(34)26(19(5)6)32(8)28(35)25(18(3)4)30-20(7)33/h9-13,15-16,18-19,25-26,31H,14H2,1-8H3,(H,29,34)(H,30,33)/b16-15-/t25-,26-/m0/s1 |
| InChIKey | QKRDCXNLINQVQN-QXYKFECQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | DOI (10.1016/s0040-4039(97)00022-1) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Terpeptin (CHEBI:209015) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S)-2-acetamido-N,3-dimethyl-N-[(2S)-3-methyl-1-[[(Z)-2-[2-(3-methylbut-2-enyl)-1H-indol-3-yl]ethenyl]amino]-1-oxobutan-2-yl]butanamide |
| Manual Xrefs | Databases |
|---|---|
| 8088713 | ChemSpider |