EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H56N6O8 |
| Net Charge | 0 |
| Average Mass | 772.944 |
| Monoisotopic Mass | 772.41596 |
| SMILES | COC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)C[C@H](O)[C@H](Cc1ccccc1)NC(=O)[C@@H](CCCNC(N)=NCC=C(C)C)NC(=O)CCCc1ccc(O)cc1 |
| InChI | InChI=1S/C42H56N6O8/c1-28(2)22-24-45-42(43)44-23-8-12-34(46-38(52)13-7-11-29-14-18-32(49)19-15-29)40(54)48-35(25-30-9-5-4-6-10-30)37(51)27-39(53)47-36(41(55)56-3)26-31-16-20-33(50)21-17-31/h4-6,9-10,14-22,34-37,49-51H,7-8,11-13,23-27H2,1-3H3,(H,46,52)(H,47,53)(H,48,54)(H3,43,44,45)/t34-,35+,36+,37+/m1/s1 |
| InChIKey | LJZRCNQLPJLGAY-HQPLKVBUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stictaspecies (ncbitaxon:2012247) | - | PubMed (21500817) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Stictamide C (CHEBI:208887) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| methyl (2S)-2-[[(3S,4S)-3-hydroxy-4-[[(2R)-2-[4-(4-hydroxyphenyl)butanoylamino]-5-[[N'-(3-methylbut-2-enyl)carbamimidoyl]amino]pentanoyl]amino]-5-phenylpentanoyl]amino]-3-(4-hydroxyphenyl)propanoate |
| Manual Xrefs | Databases |
|---|---|
| 25948198 | ChemSpider |