EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H41N3O6S |
| Net Charge | 0 |
| Average Mass | 511.685 |
| Monoisotopic Mass | 511.27161 |
| SMILES | CCCCCCC[C@H](N)[C@H](O)C(=O)N(C)[C@@H](CCSC)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C25H41N3O6S/c1-4-5-6-7-8-9-19(26)22(30)24(32)28(2)21(14-15-35-3)23(31)27-20(25(33)34)16-17-10-12-18(29)13-11-17/h10-13,19-22,29-30H,4-9,14-16,26H2,1-3H3,(H,27,31)(H,33,34)/t19-,20-,21-,22-/m0/s1 |
| InChIKey | XYXASPCRONZBJP-CMOCDZPBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Microcystis (ncbitaxon:1125) | - | PubMed (29405714) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Microginin 511 (CHEBI:208886) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S)-2-[[(2S,3S)-3-amino-2-hydroxydecanoyl]-methylamino]-4-methylsulanylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78440675 | ChemSpider |