EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O5 |
| Net Charge | 0 |
| Average Mass | 282.336 |
| Monoisotopic Mass | 282.14672 |
| SMILES | C=C(C)[C@]1(O)CC[C@]23CO[C@H](C2)[C@@](O)(C(=O)O)CC[C@H]31 |
| InChI | InChI=1S/C15H22O5/c1-9(2)14(18)6-5-13-7-11(20-8-13)15(19,12(16)17)4-3-10(13)14/h10-11,18-19H,1,3-8H2,2H3,(H,16,17)/t10-,11-,13-,14-,15-/m1/s1 |
| InChIKey | SMLOBFXLRPFWMO-OKNSCYNVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium griseofulvum (ncbitaxon:5078) | - | PubMed (31470535) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Penigrisacid D (CHEBI:208850) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| IUPAC Name |
|---|
| (1S,4S,5R,8R,9R)-4,8-dihydroxy-4-prop-1-en-2-yl-10-oxatricyclo[7.2.1.01,5]dodecane-8-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 81131464 | ChemSpider |