EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H69N7O10 |
| Net Charge | 0 |
| Average Mass | 784.009 |
| Monoisotopic Mass | 783.51059 |
| SMILES | CCCCCCCC(=O)NCC(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)C(=O)NC(C)(C)C(=O)N[C@@H](CO)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)O)[C@@H](C)CC |
| InChI | InChI=1S/C38H69N7O10/c1-11-13-14-15-16-17-29(47)39-20-30(48)40-25(8)32(49)41-26(18-22(3)4)34(51)45-38(9,10)37(55)43-28(21-46)33(50)44-31(24(7)12-2)35(52)42-27(36(53)54)19-23(5)6/h22-28,31,46H,11-21H2,1-10H3,(H,39,47)(H,40,48)(H,41,49)(H,42,52)(H,43,55)(H,44,50)(H,45,51)(H,53,54)/t24-,25-,26-,27-,28-,31-/m0/s1 |
| InChIKey | RXBPMQROEPWYAU-POOCDACNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trichoderma velutinum (ncbitaxon:202918) | - | PubMed (29373791) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lipovelutibol A (CHEBI:208816) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S,3S)-2-[[(2S)-3-hydroxy-2-[[2-methyl-2-[[(2S)-4-methyl-2-[[(2S)-2-[[2-(octanoylamino)acetyl]amino]propanoyl]amino]pentanoyl]amino]propanoyl]amino]propanoyl]amino]-3-methylpentanoyl]amino]-4-methylpentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78440567 | ChemSpider |