EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18O7 |
| Net Charge | 0 |
| Average Mass | 358.346 |
| Monoisotopic Mass | 358.10525 |
| SMILES | CO[C@@H]1C(=O)C(=CO)[C@@]2(O)C(=O)c3c(ccc4c3CCC4=O)[C@@]2(C)[C@@H]1O |
| InChI | InChI=1S/C19H18O7/c1-18-10-5-3-8-9(4-6-12(8)21)13(10)16(23)19(18,25)11(7-20)14(22)15(26-2)17(18)24/h3,5,7,15,17,20,24-25H,4,6H2,1-2H3/t15-,17-,18+,19-/m1/s1 |
| InChIKey | PYZXICLXXLMOLK-OQIJWPOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hymenoscyphus fraxineus (ncbitaxon:746836) | - | PubMed (22732888) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| B-norviridin enol (CHEBI:208740) is a fluorenes (CHEBI:24059) |
| IUPAC Name |
|---|
| (5bS,6S,7S,9aR)-6,9a-dihydroxy-9-(hydroxymethylidene)-7-methoxy-5b-methyl-1,2,6,7-tetrahydrocyclopenta[a]luorene-3,8,10-trione |
| Manual Xrefs | Databases |
|---|---|
| 78437372 | ChemSpider |