EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12N2O3 |
| Net Charge | 0 |
| Average Mass | 244.250 |
| Monoisotopic Mass | 244.08479 |
| SMILES | CC1=N[C@H](C(=O)O)Cc2c1nc1cc(O)ccc21 |
| InChI | InChI=1S/C13H12N2O3/c1-6-12-9(5-11(14-6)13(17)18)8-3-2-7(16)4-10(8)15-12/h2-4,11,15-16H,5H2,1H3,(H,17,18)/t11-/m0/s1 |
| InChIKey | KSNGZQWONODVBX-NSHDSACASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cortinarius brunneus (ncbitaxon:86082) | - | PubMed (17854153) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Brunnein A (CHEBI:208729) is a harmala alkaloid (CHEBI:61379) |
| IUPAC Name |
|---|
| (3S)-7-hydroxy-1-methyl-4,9-dihydro-3H-pyrido[3,4-b]indole-3-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 23310369 | ChemSpider |