EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28O2 |
| Net Charge | 0 |
| Average Mass | 288.431 |
| Monoisotopic Mass | 288.20893 |
| SMILES | CCCCCc1ccc(Cc2ccc(CCCCC)o2)o1 |
| InChI | InChI=1S/C19H28O2/c1-3-5-7-9-16-11-13-18(20-16)15-19-14-12-17(21-19)10-8-6-4-2/h11-14H,3-10,15H2,1-2H3 |
| InChIKey | KWXAJQOUCLOVRY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Flavodon (ncbitaxon:559738) | - | PubMed (23234367) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Flavodonfuran (CHEBI:208615) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| 2-pentyl-5-[(5-pentyluran-2-yl)methyl]uran |
| Manual Xrefs | Databases |
|---|---|
| 30829913 | ChemSpider |