EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H46N6O11 |
| Net Charge | 0 |
| Average Mass | 750.806 |
| Monoisotopic Mass | 750.32246 |
| SMILES | N[C@@H](CCCCNC(=O)CNC(=O)c1cccc(O)c1O)C(=O)N[C@@H](CCCCNC(=O)c1cccc(O)c1O)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C37H46N6O11/c38-25(14-4-6-18-39-30(46)21-41-34(50)24-13-9-17-29(45)32(24)48)35(51)42-26(36(52)43-27(37(53)54)20-22-10-2-1-3-11-22)15-5-7-19-40-33(49)23-12-8-16-28(44)31(23)47/h1-3,8-13,16-17,25-27,44-45,47-48H,4-7,14-15,18-21,38H2,(H,39,46)(H,40,49)(H,41,50)(H,42,51)(H,43,52)(H,53,54)/t25-,26-,27-/m0/s1 |
| InChIKey | AQVANOYBWBHIEH-QKDODKLFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aeromonas hydrophila (ncbitaxon:644) | - | DOI (10.1021/ja00089a058) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Amonabactin P 750 (CHEBI:208603) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S)-2-[[(2S)-2-amino-6-[[2-[(2,3-dihydroxybenzoyl)amino]acetyl]amino]hexanoyl]amino]-6-[(2,3-dihydroxybenzoyl)amino]hexanoyl]amino]-3-phenylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78440345 | ChemSpider |