EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H24O8 |
| Net Charge | 0 |
| Average Mass | 440.448 |
| Monoisotopic Mass | 440.14712 |
| SMILES | O=C1OCCCCOC(=O)c2ccc(cc2)C(=O)OCCCCOC(=O)c2ccc1cc2 |
| InChI | InChI=1S/C24H24O8/c25-21-17-5-7-19(8-6-17)23(27)31-15-3-4-16-32-24(28)20-11-9-18(10-12-20)22(26)30-14-2-1-13-29-21/h5-12H,1-4,13-16H2 |
| InChIKey | SFNCDJVWOAZMFE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cytophaga (ncbitaxon:978) | - | PubMed (12444694) |
| Roles Classification |
|---|
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pharacine (CHEBI:208599) is a phthalate ester (CHEBI:35484) |
| IUPAC Name |
|---|
| 3,8,15,20-tetraoxatricyclo[20.2.2.210,13]octacosa-1(25),10,12,22(26),23,27-hexaene-2,9,14,21-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 8631328 | ChemSpider |