EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H40N4O6 |
| Net Charge | 0 |
| Average Mass | 588.705 |
| Monoisotopic Mass | 588.29478 |
| SMILES | CC(C)[C@@H]1OC(=O)[C@@H]2CCCN2C(=O)[C@@H](Cc2ccccc2)NC(=O)[C@@H]2CCCN2C(=O)[C@@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C33H40N4O6/c1-21(2)28-30(39)35-25(20-23-13-7-4-8-14-23)31(40)36-17-9-15-26(36)29(38)34-24(19-22-11-5-3-6-12-22)32(41)37-18-10-16-27(37)33(42)43-28/h3-8,11-14,21,24-28H,9-10,15-20H2,1-2H3,(H,34,38)(H,35,39)/t24-,25-,26+,27+,28+/m1/s1 |
| InChIKey | IZCWSRIIMBIBGB-MASCHLQQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alternariaspecies SF-5016 (ncbitaxon:678553) | - | PubMed (19943624) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Alternaramide (CHEBI:208555) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (3R,6S,12R,15S,18S)-3,12-dibenzyl-15-propan-2-yl-16-oxa-1,4,10,13-tetrazatricyclo[16.3.0.06,10]henicosane-2,5,11,14,17-pentone |
| Manual Xrefs | Databases |
|---|---|
| 24684136 | ChemSpider |