EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H40N4O5 |
| Net Charge | 0 |
| Average Mass | 524.662 |
| Monoisotopic Mass | 524.29987 |
| SMILES | CC[C@@H](C)[C@H](N)C(=O)N(C)[C@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C29H40N4O5/c1-6-19(4)25(30)28(36)33(5)24(17-20-12-8-7-9-13-20)27(35)32-23(16-18(2)3)26(34)31-22-15-11-10-14-21(22)29(37)38/h7-15,18-19,23-25H,6,16-17,30H2,1-5H3,(H,31,34)(H,32,35)(H,37,38)/t19-,23+,24-,25+/m1/s1 |
| InChIKey | NBHDIKSJKKZUEO-MNVNNWCQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hirsutella (ncbitaxon:42367) | - | PubMed (16643062) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hirsutellic acid A (CHEBI:208529) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 2-[[(2S)-2-[[(2R)-2-[[(2S,3R)-2-amino-3-methylpentanoyl]-methylamino]-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 9838385 | ChemSpider |