EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9NO4 |
| Net Charge | 0 |
| Average Mass | 183.163 |
| Monoisotopic Mass | 183.05316 |
| SMILES | COc1cc(O)c(N)c(C(=O)O)c1 |
| InChI | InChI=1S/C8H9NO4/c1-13-4-2-5(8(11)12)7(9)6(10)3-4/h2-3,10H,9H2,1H3,(H,11,12) |
| InChIKey | NTAPPSMRVZNEPP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-Methoxy-3-hydroxyanthranilate (CHEBI:2085) is a methoxybenzoic acid (CHEBI:25238) |
| Synonyms | Source |
|---|---|
| 5-Methoxy-3-hydroxyanthranilate | KEGG COMPOUND |
| 5-Methoxy-3-hydroxyanthranilic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C11466 | KEGG COMPOUND |