EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H66N4O8 |
| Net Charge | 0 |
| Average Mass | 694.955 |
| Monoisotopic Mass | 694.48807 |
| SMILES | CCC(C)CCCCCCC[C@@H]1CC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(=O)O)C(=O)O1 |
| InChI | InChI=1S/C37H66N4O8/c1-9-26(8)15-13-11-10-12-14-16-27-22-32(42)38-29(19-23(2)3)34(45)40-31(21-25(6)7)36(47)41-30(20-24(4)5)35(46)39-28(37(48)49-27)17-18-33(43)44/h23-31H,9-22H2,1-8H3,(H,38,42)(H,39,46)(H,40,45)(H,41,47)(H,43,44)/t26?,27-,28+,29+,30+,31+/m1/s1 |
| InChIKey | UBOCYUXOELCZII-REVKYEQOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus (ncbitaxon:1386) | - | PubMed (29115831) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Bacilotetrin A (CHEBI:208491) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| 3-[(3S,6S,9S,12S,16R)-16-(8-methyldecyl)-6,9,12-tris(2-methylpropyl)-2,5,8,11,14-pentaoxo-1-oxa-4,7,10,13-tetrazacyclohexadec-3-yl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 62765038 | ChemSpider |