EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H25N3O6 |
| Net Charge | 0 |
| Average Mass | 331.369 |
| Monoisotopic Mass | 331.17434 |
| SMILES | CC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C14H25N3O6/c1-7(2)5-10(16-9(4)19)12(20)17-11(6-18)13(21)15-8(3)14(22)23/h7-8,10-11,18H,5-6H2,1-4H3,(H,15,21)(H,16,19)(H,17,20)(H,22,23)/t8-,10-,11-/m0/s1 |
| InChIKey | CCDHJFKYGOQXFH-LSJOCFKGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (29311676) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-L-leucine-L-serine-L-alanine (CHEBI:208460) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S)-2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]-3-hydroxypropanoyl]amino]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 64076322 | ChemSpider |