EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H49N5O7 |
| Net Charge | 0 |
| Average Mass | 603.761 |
| Monoisotopic Mass | 603.36320 |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](Cc2ccc(O)cc2)NC1=O |
| InChI | InChI=1S/C31H49N5O7/c1-8-18(6)25-30(42)34-24(15-20-9-11-21(38)12-10-20)29(41)36-26(19(7)37)31(43)33-22(13-16(2)3)27(39)32-23(14-17(4)5)28(40)35-25/h9-12,16-19,22-26,37-38H,8,13-15H2,1-7H3,(H,32,39)(H,33,43)(H,34,42)(H,35,40)(H,36,41)/t18-,19+,22+,23-,24-,25-,26-/m0/s1 |
| InChIKey | XIIOIZOTIZPWAI-CLARFEIDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus (ncbitaxon:1386) | - | PubMed (30456957) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Seongsanamide F (CHEBI:208394) is a cyclic peptide (CHEBI:23449) |
| IUPAC Name |
|---|
| (3S,6S,9R,12S,15S)-3-[(2S)-butan-2-yl]-12-[(1R)-1-hydroxyethyl]-15-[(4-hydroxyphenyl)methyl]-6,9-bis(2-methylpropyl)-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11,14-pentone |
| Manual Xrefs | Databases |
|---|---|
| 71048715 | ChemSpider |