EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C44H65N7O7 |
| Net Charge | 0 |
| Average Mass | 804.046 |
| Monoisotopic Mass | 803.49455 |
| SMILES | CC[C@@H](C)[C@H]1NC(=O)[C@@H](C)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@@H](CC(C)C)NC(=O)[C@@H](C(C)C)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@@H]([C@H](C)CC)NC1=O |
| InChI | InChI=1S/C44H65N7O7/c1-10-27(7)36-43(57)48-34(24-31-20-16-13-17-21-31)41(55)49-35(26(5)6)42(56)47-32(22-25(3)4)40(54)46-33(23-30-18-14-12-15-19-30)39(53)45-29(9)38(52)50-37(28(8)11-2)44(58)51-36/h12-21,25-29,32-37H,10-11,22-24H2,1-9H3,(H,45,53)(H,46,54)(H,47,56)(H,48,57)(H,49,55)(H,50,52)(H,51,58)/t27-,28-,29-,32-,33+,34+,35-,36-,37-/m1/s1 |
| InChIKey | BIFRDWYFLXYEGO-CJJSJBDISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mortierellaspecies (ncbitaxon:1715235) | - | PubMed (28921982) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mortiamide D (CHEBI:208365) is a cyclic peptide (CHEBI:23449) |
| IUPAC Name |
|---|
| (3S,6R,9R,12R,15S,18R,21R)-3,15-dibenzyl-6,9-bis[(2R)-butan-2-yl]-12-methyl-18-(2-methylpropyl)-21-propan-2-yl-1,4,7,10,13,16,19-heptazacyclohenicosane-2,5,8,11,14,17,20-heptone |
| Manual Xrefs | Databases |
|---|---|
| 78440566 | ChemSpider |