EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H67N7O7 |
| Net Charge | 0 |
| Average Mass | 770.029 |
| Monoisotopic Mass | 769.51020 |
| SMILES | CC[C@@H](C)[C@H]1NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@@H]([C@H](C)CC)NC(=O)[C@@H](C(C)C)NC(=O)[C@@H]([C@H](C)CC)NC(=O)[C@H]([C@@H](C)CC)NC(=O)[C@@H](C)NC1=O |
| InChI | InChI=1S/C41H67N7O7/c1-12-23(7)31-38(52)42-27(11)35(49)45-33(25(9)14-3)41(55)48-34(26(10)15-4)40(54)44-30(22(5)6)37(51)47-32(24(8)13-2)39(53)43-29(36(50)46-31)21-28-19-17-16-18-20-28/h16-20,22-27,29-34H,12-15,21H2,1-11H3,(H,42,52)(H,43,53)(H,44,54)(H,45,49)(H,46,50)(H,47,51)(H,48,55)/t23-,24-,25+,26-,27-,29+,30-,31-,32-,33+,34-/m1/s1 |
| InChIKey | APKNPYLTWRYLIE-UXQKBCBTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mortierellaspecies (ncbitaxon:1715235) | - | PubMed (28921982) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mortiamide C (CHEBI:208358) is a cyclic peptide (CHEBI:23449) |
| IUPAC Name |
|---|
| (3S,6R,9R,12R,15S,18R,21R)-3-benzyl-15-[(2S)-butan-2-yl]-6,12,21-tris[(2R)-butan-2-yl]-18-methyl-9-propan-2-yl-1,4,7,10,13,16,19-heptazacyclohenicosane-2,5,8,11,14,17,20-heptone |
| Manual Xrefs | Databases |
|---|---|
| 78440565 | ChemSpider |