EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H38N2O9 |
| Net Charge | 0 |
| Average Mass | 534.606 |
| Monoisotopic Mass | 534.25773 |
| SMILES | CCC(C)C1OC(=O)[C@@H](NC(=O)c2cccc(N)c2O)[C@@H](C)OC(=O)C(C)(C)C(=O)C(CC(C)C)OC1=O |
| InChI | InChI=1S/C27H38N2O9/c1-8-14(4)21-25(34)37-18(12-13(2)3)22(31)27(6,7)26(35)36-15(5)19(24(33)38-21)29-23(32)16-10-9-11-17(28)20(16)30/h9-11,13-15,18-19,21,30H,8,12,28H2,1-7H3,(H,29,32)/t14?,15-,18?,19+,21?/m1/s1 |
| InChIKey | BSCCLPUIXMSPIT-FIILAKESSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (23756369) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-amino-N-[(6S,7R)-3-butan-2-yl-7,10,10-trimethyl-12-(2-methylpropyl)-2,5,9,11-tetraoxo-1,4,8-trioxacyclododec-6-yl]-2-hydroxybenzamide (CHEBI:208345) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| 3-amino-N-[(6S,7R)-3-butan-2-yl-7,10,10-trimethyl-12-(2-methylpropyl)-2,5,9,11-tetraoxo-1,4,8-trioxacyclododec-6-yl]-2-hydroxybenzamide |
| Manual Xrefs | Databases |
|---|---|
| 78445520 | ChemSpider |