EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H36N4O7 |
| Net Charge | 0 |
| Average Mass | 516.595 |
| Monoisotopic Mass | 516.25840 |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@@H](NC(=O)/C=C/c2ccc(O)cc2)[C@@H](C)OC(=O)[C@@H](C)CNC(=O)[C@@H](C)NC1=O |
| InChI | InChI=1S/C26H36N4O7/c1-14(2)12-20-24(34)28-16(4)23(33)27-13-15(3)26(36)37-17(5)22(25(35)29-20)30-21(32)11-8-18-6-9-19(31)10-7-18/h6-11,14-17,20,22,31H,12-13H2,1-5H3,(H,27,33)(H,28,34)(H,29,35)(H,30,32)/b11-8+/t15-,16+,17+,20-,22-/m0/s1 |
| InChIKey | GXKRFCOMAWYRAO-CSGOZAJOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillusspecies SCSGAF 0076 (ncbitaxon:1500550) | - | DOI (10.1016/j.tet.2013.01.021) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aspergillipeptide A (CHEBI:208338) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (E)-3-(4-hydroxyphenyl)-N-[(2R,3S,6S,9R,13S)-2,9,13-trimethyl-6-(2-methylpropyl)-4,7,10,14-tetraoxo-1-oxa-5,8,11-triazacyclotetradec-3-yl]prop-2-enamide |
| Manual Xrefs | Databases |
|---|---|
| 29215474 | ChemSpider |