EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H31NO5S2 |
| Net Charge | 0 |
| Average Mass | 453.626 |
| Monoisotopic Mass | 453.16437 |
| SMILES | CCCC(SSCC(NC(C)=O)C(=O)O)c1cc(C)ccc1/C=C/CCCC(=O)O |
| InChI | InChI=1S/C22H31NO5S2/c1-4-8-20(30-29-14-19(22(27)28)23-16(3)24)18-13-15(2)11-12-17(18)9-6-5-7-10-21(25)26/h6,9,11-13,19-20H,4-5,7-8,10,14H2,1-3H3,(H,23,24)(H,25,26)(H,27,28)/b9-6+ |
| InChIKey | IZPIIKDCVJWAGQ-RMKNXTFCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (28990780) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lorneic acid I (CHEBI:208334) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| (E)-6-[2-[1-[(2-acetamido-2-carboxyethyl)disulanyl]butyl]-4-methylphenyl]hex-5-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78435781 | ChemSpider |