EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H29NO6 |
| Net Charge | 0 |
| Average Mass | 499.563 |
| Monoisotopic Mass | 499.19949 |
| SMILES | COC(=O)[C@H]1CCC(=O)N1Cc1cc(OC)c2c(OC)cc3cc(OCc4ccccc4)ccc3c2c1 |
| InChI | InChI=1S/C30H29NO6/c1-34-26-14-20(17-31-25(30(33)36-3)11-12-28(31)32)13-24-23-10-9-22(37-18-19-7-5-4-6-8-19)15-21(23)16-27(35-2)29(24)26/h4-10,13-16,25H,11-12,17-18H2,1-3H3/t25-/m1/s1 |
| InChIKey | KAEUCZLRBGCTLN-RUZDIDTESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Colletotrichum gloeosporioides (ncbitaxon:474922) | - | PubMed (29035525) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glomephenanthrene A (CHEBI:208284) is a phenanthrol (CHEBI:25962) |
| IUPAC Name |
|---|
| methyl (2R)-1-[(1,10-dimethoxy-7-phenylmethoxyphenanthren-3-yl)methyl]-5-oxopyrrolidine-2-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 78439003 | ChemSpider |