EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H31NO2 |
| Net Charge | 0 |
| Average Mass | 305.462 |
| Monoisotopic Mass | 305.23548 |
| SMILES | CC(O)CCCCC[C@@H]1C[C@H](O)[C@H](Cc2ccccc2)N1C |
| InChI | InChI=1S/C19H31NO2/c1-15(21)9-5-3-8-12-17-14-19(22)18(20(17)2)13-16-10-6-4-7-11-16/h4,6-7,10-11,15,17-19,21-22H,3,5,8-9,12-14H2,1-2H3/t15?,17-,18+,19+/m1/s1 |
| InChIKey | AGVBGMYMFOZECS-QTMSITBTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (30350993) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Preubetain J (CHEBI:208283) is a aralkylamine (CHEBI:18000) |
| IUPAC Name |
|---|
| (2S,3S,5R)-2-benzyl-5-(6-hydroxyheptyl)-1-methylpyrrolidin-3-ol |
| Manual Xrefs | Databases |
|---|---|
| 71048911 | ChemSpider |