EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H42O9 |
| Net Charge | 0 |
| Average Mass | 498.613 |
| Monoisotopic Mass | 498.28288 |
| SMILES | C=C[C@@]1(C)CCC2=C(C1)[C@H](O)C[C@H]1[C@@](C)(CO[C@@H]3O[C@H](CO)[C@@H](O)[C@@H](O)[C@@H]3O)[C@@H](O)[C@H](O)C[C@]21C |
| InChI | InChI=1S/C26H42O9/c1-5-24(2)7-6-14-13(9-24)15(28)8-18-25(14,3)10-16(29)22(33)26(18,4)12-34-23-21(32)20(31)19(30)17(11-27)35-23/h5,15-23,27-33H,1,6-12H2,2-4H3/t15-,16-,17-,18-,19-,20-,21+,22+,23-,24+,25-,26-/m1/s1 |
| InChIKey | VPOQGGIEJOGANK-QLBSNHMZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sagenomella striatispora (ncbitaxon:743106) | - | PubMed (16854717) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Virescenoside X (CHEBI:208257) is a steroid saponin (CHEBI:61655) |
| IUPAC Name |
|---|
| (2R,3S,4R,5S,6R)-2-[[(1S,2R,3R,4aS,7S,9R,10aR)-7-ethenyl-2,3,9-trihydroxy-1,4a,7-trimethyl-3,4,5,6,8,9,10,10a-octahydro-2H-phenanthren-1-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| Manual Xrefs | Databases |
|---|---|
| 29213642 | ChemSpider |