EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H27NO3 |
| Net Charge | 0 |
| Average Mass | 305.418 |
| Monoisotopic Mass | 305.19909 |
| SMILES | CN1[C@H](CCCCCC(=O)O)C[C@H](O)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C18H27NO3/c1-19-15(10-6-3-7-11-18(21)22)13-17(20)16(19)12-14-8-4-2-5-9-14/h2,4-5,8-9,15-17,20H,3,6-7,10-13H2,1H3,(H,21,22)/t15-,16+,17+/m1/s1 |
| InChIKey | OPWWWRSNMOKTDE-IKGGRYGDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (30350993) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Preubetain E (CHEBI:208254) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| 6-[(2R,4S,5S)-5-benzyl-4-hydroxy-1-methylpyrrolidin-2-yl]hexanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 71048906 | ChemSpider |