EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H25NO3 |
| Net Charge | 0 |
| Average Mass | 291.391 |
| Monoisotopic Mass | 291.18344 |
| SMILES | CN1[C@H](CCCCC(=O)O)C[C@H](O)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C17H25NO3/c1-18-14(9-5-6-10-17(20)21)12-16(19)15(18)11-13-7-3-2-4-8-13/h2-4,7-8,14-16,19H,5-6,9-12H2,1H3,(H,20,21)/t14-,15+,16+/m1/s1 |
| InChIKey | BZVWIWXADKMNCO-PMPSAXMXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (30350993) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Preubetain D (CHEBI:208249) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| 5-[(2R,4S,5S)-5-benzyl-4-hydroxy-1-methylpyrrolidin-2-yl]pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 71048905 | ChemSpider |