EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O2 |
| Net Charge | 0 |
| Average Mass | 440.712 |
| Monoisotopic Mass | 440.36543 |
| SMILES | C=C(C[C@@H](O)[C@@H](C)[C@H]1CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CCC(=O)[C@@H](C)[C@@H]1CC3)C(C)C |
| InChI | InChI=1S/C30H48O2/c1-18(2)19(3)17-27(32)21(5)23-11-15-30(8)25-10-9-22-20(4)26(31)13-14-28(22,6)24(25)12-16-29(23,30)7/h18,20-23,27,32H,3,9-17H2,1-2,4-8H3/t20-,21-,22-,23+,27+,28-,29+,30-/m0/s1 |
| InChIKey | SCNVZHXBWGDYGK-PZDNYWHUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fuscoporia gilva (ncbitaxon:40471) | - | PubMed (19261312) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gilvsin C (CHEBI:208208) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (4S,5S,10S,13R,14R,17R)-17-[(2S,3R)-3-hydroxy-6-methyl-5-methylideneheptan-2-yl]-4,10,13,14-tetramethyl-2,4,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| Manual Xrefs | Databases |
|---|---|
| 78441080 | ChemSpider |