EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H44N6O7 |
| Net Charge | 0 |
| Average Mass | 612.728 |
| Monoisotopic Mass | 612.32715 |
| SMILES | CC1C[C@@H](C(=O)N[C@@H](CO)CCCN=C(N)N)N(C(=O)[C@@H](Cc2ccc(O)cc2)NC(=O)C(O)CCc2ccc(O)cc2)C1 |
| InChI | InChI=1S/C31H44N6O7/c1-19-15-26(28(42)35-22(18-38)3-2-14-34-31(32)33)37(17-19)30(44)25(16-21-6-11-24(40)12-7-21)36-29(43)27(41)13-8-20-4-9-23(39)10-5-20/h4-7,9-12,19,22,25-27,38-41H,2-3,8,13-18H2,1H3,(H,35,42)(H,36,43)(H4,32,33,34)/t19?,22-,25-,26+,27?/m1/s1 |
| InChIKey | OYLLIRIQZZWJCJ-CBJUXADFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sphaerospermopsis torques-reginae ITEP-024 (ncbitaxon:984208) | - | PubMed (28876933) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dihydrospumigin K (CHEBI:208186) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| (2S)-N-[(2R)-5-(diaminomethylideneamino)-1-hydroxypentan-2-yl]-1-[(2R)-2-[[2-hydroxy-4-(4-hydroxyphenyl)butanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]-4-methylpyrrolidine-2-carboxamide |
| Manual Xrefs | Databases |
|---|---|
| 78439000 | ChemSpider |