EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H45N5O7 |
| Net Charge | 0 |
| Average Mass | 575.707 |
| Monoisotopic Mass | 575.33190 |
| SMILES | CC[C@@H](C)[C@H](NC(=O)N[C@@H]1CCCCNC(=O)[C@H](CCc2ccc(O)cc2)NC(=O)[C@H]([C@H](C)CC)NC1=O)C(=O)O |
| InChI | InChI=1S/C29H45N5O7/c1-5-17(3)23-27(38)31-22(15-12-19-10-13-20(35)14-11-19)25(36)30-16-8-7-9-21(26(37)33-23)32-29(41)34-24(28(39)40)18(4)6-2/h10-11,13-14,17-18,21-24,35H,5-9,12,15-16H2,1-4H3,(H,30,36)(H,31,38)(H,33,37)(H,39,40)(H2,32,34,41)/t17-,18-,21-,22+,23+,24+/m1/s1 |
| InChIKey | BEGARHAEPVBWAE-XKTNGNEZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sphaerospermopsis torques-reginae ITEP-024 (ncbitaxon:984208) | - | PubMed (28876933) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Namalide B (CHEBI:208180) is a cyclic peptide (CHEBI:23449) |
| IUPAC Name |
|---|
| (2S,3R)-2-[[(3S,6S,9R)-6-[(2R)-butan-2-yl]-3-[2-(4-hydroxyphenyl)ethyl]-2,5,8-trioxo-1,4,7-triazacyclotridec-9-yl]carbamoylamino]-3-methylpentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78438998 | ChemSpider |