EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H58ClN5O9 |
| Net Charge | 0 |
| Average Mass | 788.383 |
| Monoisotopic Mass | 787.39231 |
| SMILES | CC[C@H](C)[C@@H](C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O)N(C)C(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](O)[C@H](N)CCCCCCCCl |
| InChI | InChI=1S/C40H58ClN5O9/c1-4-25(2)34(39(53)46-22-10-12-33(46)36(50)44-32(40(54)55)24-27-15-19-29(48)20-16-27)45(3)38(52)31(23-26-13-17-28(47)18-14-26)43-37(51)35(49)30(42)11-8-6-5-7-9-21-41/h13-20,25,30-35,47-49H,4-12,21-24,42H2,1-3H3,(H,43,51)(H,44,50)(H,54,55)/t25-,30+,31-,32-,33-,34-,35-/m0/s1 |
| InChIKey | XYGVUPXPWWMUAK-YGKFCERESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Microcystisspecies (ncbitaxon:1127) | - | DOI (10.1016/j.tet.2011.04.042) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Microginin GH787 (CHEBI:208166) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S)-1-[(2S,3S)-2-[[(2S)-2-[[(2S,3R)-3-amino-10-chloro-2-hydroxydecanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]-methylamino]-3-methylpentanoyl]pyrrolidine-2-carbonyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 28288773 | ChemSpider |